C13H18F3NO6 — CID 59900164
N-[(4aR,6S,7R,8R,8aS)-6-ethenoxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide (PubChem CID 59900164) has the molecular formula C13H18F3NO6 and a molecular weight of 341.28 g/mol. Its IUPAC name is N-[(4aR,6S,7R,8R,8aS)-6-ethenoxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4aR,6S,7R,8R,8aS)-6-ethenoxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59900164 |
| Molecular Formula | C13H18F3NO6 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(4aR,6S,7R,8R,8aS)-6-ethenoxy-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=CO[C@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO6/c1-4-20-10-7(17-11(19)13(14,15)16)8(18)9-6(22-10)5-21-12(2,3)23-9/h4,6-10,18H,1,5H2,2-3H3,(H,17,19)/t6-,7-,8-,9-,10+/m1/s1 |
| InChIKey | KBQWESZKLQOAEN-IGORNWKESA-N |
| XLogP | 0.43 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|