C48H37F3N2O4 — CID 59900780
5-[2-(3,4-diacetylphenyl)-1,1,1-trifluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione (PubChem CID 59900780) has the molecular formula C48H37F3N2O4 and a molecular weight of 762.83 g/mol. Its IUPAC name is 5-[2-(3,4-diacetylphenyl)-1,1,1-trifluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-(3,4-diacetylphenyl)-1,1,1-trifluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59900780 |
| Molecular Formula | C48H37F3N2O4 |
| Molecular Weight | 762.83 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | 5-[2-(3,4-diacetylphenyl)-1,1,1-trifluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)phenyl]fluoren-9-yl]phenyl]isoindole-1,3-dione |
| SMILES | CC(=O)c1ccc(C(C)(c2ccc3c(c2)C(=O)N(c2ccc(C4(c5ccc(N(C)C)cc5)c5ccccc5-c5ccccc54)cc2)C3=O)C(F)(F)F)cc1C(C)=O |
| InChI | InChI=1S/C48H37F3N2O4/c1-28(54)36-24-18-32(26-40(36)29(2)55)46(3,48(49,50)51)33-19-25-39-41(27-33)45(57)53(44(39)56)35-22-16-31(17-23-35)47(30-14-20-34(21-15-30)52(4)5)42-12-8-6-10-37(42)38-11-7-9-13-43(38)47/h6-27H,1-5H3 |
| InChIKey | KJZJNTMQTFJCPH-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.83 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|