About CID 59900877
CID 59900877 (PubChem CID 59900877) has the molecular formula C4H8NO
and a molecular weight of 86.11 g/mol.
Molecular Properties
| Compound Name | CID 59900877 |
| PubChem CID | 59900877 |
| Molecular Formula | C4H8NO |
| Molecular Weight | 86.11 g/mol |
| Exact Mass | 86.06 |
| IUPAC Name | — |
| SMILES | C[CH]C(=O)NC |
| InChI | InChI=1S/C4H8NO/c1-3-4(6)5-2/h3H,1-2H3,(H,5,6) |
| InChIKey | BSTQFFNIYBSGEL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.11 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59900877 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59900877?
The IUPAC name of CID 59900877 (CID 59900877) is not available.
What is the SMILES notation for CID 59900877?
The canonical SMILES for CID 59900877 is C[CH]C(=O)NC.
What is the InChIKey of CID 59900877?
The InChIKey is BSTQFFNIYBSGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO/c1-3-4(6)5-2/h3H,1-2H3,(H,5,6).
What are the key properties of CID 59900877?
CID 59900877 has a molecular weight of 86.11 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59900877 is sourced from PubChem (CID 59900877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).