About (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal
(Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal (PubChem CID 59901043) has the molecular formula C15H14FNO2
and a molecular weight of 259.28 g/mol. Its IUPAC name is (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal.
Molecular Properties
| Compound Name | (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal |
| PubChem CID | 59901043 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal |
| SMILES | C/C(=C(/F)C=O)c1cc(-c2c(C)cccc2C)no1 |
| InChI | InChI=1S/C15H14FNO2/c1-9-5-4-6-10(2)15(9)13-7-14(19-17-13)11(3)12(16)8-18/h4-8H,1-3H3/b12-11- |
| InChIKey | NOZKYHPNOYPXGU-QXMHVHEDSA-N |
| XLogP | 3.86 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal?
The IUPAC name of (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal (CID 59901043) is (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal.
What is the SMILES notation for (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal?
The canonical SMILES for (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal is C/C(=C(/F)C=O)c1cc(-c2c(C)cccc2C)no1.
What is the InChIKey of (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal?
The InChIKey is NOZKYHPNOYPXGU-QXMHVHEDSA-N. The full InChI is InChI=1S/C15H14FNO2/c1-9-5-4-6-10(2)15(9)13-7-14(19-17-13)11(3)12(16)8-18/h4-8H,1-3H3/b12-11-.
What are the key properties of (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal?
(Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal has a molecular weight of 259.28 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[3-(2,6-dimethylphenyl)-1,2-oxazol-5-yl]-2-fluorobut-2-enal is sourced from PubChem (CID 59901043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).