C19H24N2O — CID 59901206
(1R)-N,1'-dimethyl-N-prop-2-ynylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide (PubChem CID 59901206) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (1R)-N,1'-dimethyl-N-prop-2-ynylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide.
| Compound Name | (1R)-N,1'-dimethyl-N-prop-2-ynylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 59901206 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (1R)-N,1'-dimethyl-N-prop-2-ynylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide |
| SMILES | C#CCN(C)C(=O)[C@@H]1CC2(CCN(C)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O/c1-4-11-21(3)18(22)16-14-19(9-12-20(2)13-10-19)17-8-6-5-7-15(16)17/h1,5-8,16H,9-14H2,2-3H3/t16-/m1/s1 |
| InChIKey | BIVYESLGKXGMDB-MRXNPFEDSA-N |
| XLogP | 2.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|