C25H26N4O5S — CID 59901356
(2S)-2-(prop-2-enylsulfonylamino)-3-[4-[3-(pyridin-2-ylmethylcarbamoylamino)phenyl]phenyl]propanoic acid (PubChem CID 59901356) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is (2S)-2-(prop-2-enylsulfonylamino)-3-[4-[3-(pyridin-2-ylmethylcarbamoylamino)phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-(prop-2-enylsulfonylamino)-3-[4-[3-(pyridin-2-ylmethylcarbamoylamino)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59901356 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (2S)-2-(prop-2-enylsulfonylamino)-3-[4-[3-(pyridin-2-ylmethylcarbamoylamino)phenyl]phenyl]propanoic acid |
| SMILES | C=CCS(=O)(=O)N[C@@H](Cc1ccc(-c2cccc(NC(=O)NCc3ccccn3)c2)cc1)C(=O)O |
| InChI | InChI=1S/C25H26N4O5S/c1-2-14-35(33,34)29-23(24(30)31)15-18-9-11-19(12-10-18)20-6-5-8-21(16-20)28-25(32)27-17-22-7-3-4-13-26-22/h2-13,16,23,29H,1,14-15,17H2,(H,30,31)(H2,27,28,32)/t23-/m0/s1 |
| InChIKey | YCPHSCCQSWYWRN-QHCPKHFHSA-N |
| XLogP | 3.17 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|