C24H40O6 — CID 59901510
(3aR,4R,5R,6aS)-4-[(E)-2-(2-heptyl-1,3-dioxolan-2-yl)ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 59901510) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-2-(2-heptyl-1,3-dioxolan-2-yl)ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-2-(2-heptyl-1,3-dioxolan-2-yl)ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 59901510 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-2-(2-heptyl-1,3-dioxolan-2-yl)ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCCCCC1(/C=C/[C@@H]2[C@H]3CC(O)O[C@H]3C[C@H]2OC2CCCCO2)OCCO1 |
| InChI | InChI=1S/C24H40O6/c1-2-3-4-5-7-11-24(27-14-15-28-24)12-10-18-19-16-22(25)29-21(19)17-20(18)30-23-9-6-8-13-26-23/h10,12,18-23,25H,2-9,11,13-17H2,1H3/b12-10+/t18-,19-,20-,21+,22?,23?/m1/s1 |
| InChIKey | QMGLLEZPZWZXQW-BXERTDGBSA-N |
| XLogP | 4.30 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|