C25H40N2O5 — CID 59901593
N-[(2S,4S)-1-(ethoxymethoxy)-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-4-methylcyclohexane-1-carboxamide (PubChem CID 59901593) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is N-[(2S,4S)-1-(ethoxymethoxy)-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-[(2S,4S)-1-(ethoxymethoxy)-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59901593 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | N-[(2S,4S)-1-(ethoxymethoxy)-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-4-methylcyclohexane-1-carboxamide |
| SMILES | CCOCOC[C@H](C[C@H](CCCc1ccccc1)C(=O)NO)NC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C25H40N2O5/c1-3-31-18-32-17-23(26-24(28)21-14-12-19(2)13-15-21)16-22(25(29)27-30)11-7-10-20-8-5-4-6-9-20/h4-6,8-9,19,21-23,30H,3,7,10-18H2,1-2H3,(H,26,28)(H,27,29)/t19?,21?,22-,23-/m0/s1 |
| InChIKey | SGYSPNCSTHTJTL-VZKWCCSDSA-N |
| XLogP | 3.84 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|