C11H15NO — CID 59901883
(6Z,8E)-8-isocyanatodeca-1,6,8-triene (PubChem CID 59901883) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (6Z,8E)-8-isocyanatodeca-1,6,8-triene.
| Compound Name | (6Z,8E)-8-isocyanatodeca-1,6,8-triene |
|---|---|
| PubChem CID | 59901883 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (6Z,8E)-8-isocyanatodeca-1,6,8-triene |
| SMILES | C=CCCC/C=C\C(=C/C)N=C=O |
| InChI | InChI=1S/C11H15NO/c1-3-5-6-7-8-9-11(4-2)12-10-13/h3-4,8-9H,1,5-7H2,2H3/b9-8-,11-4+ |
| InChIKey | ILOAEDBBYXSTQQ-VIVCGJSESA-N |
| XLogP | 3.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|