C6H8O2 — CID 59901887
cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde (PubChem CID 59901887) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde.
| Compound Name | cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 59901887 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde |
| SMILES | O=C[C@@H]1CC[C@@H]1C=O |
| InChI | InChI=1S/C6H8O2/c7-3-5-1-2-6(5)4-8/h3-6H,1-2H2/t5-,6+ |
| InChIKey | NCUIVSIEOSOUQW-OLQVQODUSA-N |
| XLogP | 0.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|