About cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde
cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde (PubChem CID 59901887) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde.
Molecular Properties
| Compound Name | cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde |
| PubChem CID | 59901887 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde |
| SMILES | O=C[C@@H]1CC[C@@H]1C=O |
| InChI | InChI=1S/C6H8O2/c7-3-5-1-2-6(5)4-8/h3-6H,1-2H2/t5-,6+ |
| InChIKey | NCUIVSIEOSOUQW-OLQVQODUSA-N |
| XLogP | 0.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde?
The IUPAC name of cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde (CID 59901887) is cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde.
What is the SMILES notation for cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde?
The canonical SMILES for cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde is O=C[C@@H]1CC[C@@H]1C=O.
What is the InChIKey of cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde?
The InChIKey is NCUIVSIEOSOUQW-OLQVQODUSA-N. The full InChI is InChI=1S/C6H8O2/c7-3-5-1-2-6(5)4-8/h3-6H,1-2H2/t5-,6+.
What are the key properties of cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde?
cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde has a molecular weight of 112.13 g/mol, XLogP of 0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-cyclobutane-1,2-dicarbaldehyde is sourced from PubChem (CID 59901887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).