About CID 59901942
CID 59901942 (PubChem CID 59901942) has the molecular formula C7H12N
and a molecular weight of 110.18 g/mol.
Molecular Properties
| Compound Name | CID 59901942 |
| PubChem CID | 59901942 |
| Molecular Formula | C7H12N |
| Molecular Weight | 110.18 g/mol |
| Exact Mass | 110.10 |
| IUPAC Name | — |
| SMILES | [CH]C(C)C(=[CH])N(C)C |
| InChI | InChI=1S/C7H12N/c1-6(2)7(3)8(4)5/h1,3,6H,2,4-5H3 |
| InChIKey | XAQNHGSZVFDJAF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59901942 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59901942?
The IUPAC name of CID 59901942 (CID 59901942) is not available.
What is the SMILES notation for CID 59901942?
The canonical SMILES for CID 59901942 is [CH]C(C)C(=[CH])N(C)C.
What is the InChIKey of CID 59901942?
The InChIKey is XAQNHGSZVFDJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N/c1-6(2)7(3)8(4)5/h1,3,6H,2,4-5H3.
What are the key properties of CID 59901942?
CID 59901942 has a molecular weight of 110.18 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59901942 is sourced from PubChem (CID 59901942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).