About CID 59901972
CID 59901972 (PubChem CID 59901972) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol.
Molecular Properties
| Compound Name | CID 59901972 |
| PubChem CID | 59901972 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | — |
| SMILES | [CH]=C([CH]C)N(C)C |
| InChI | InChI=1S/C6H11N/c1-5-6(2)7(3)4/h2,5H,1,3-4H3 |
| InChIKey | TXVVTTIBIQMWQM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59901972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59901972?
The IUPAC name of CID 59901972 (CID 59901972) is not available.
What is the SMILES notation for CID 59901972?
The canonical SMILES for CID 59901972 is [CH]=C([CH]C)N(C)C.
What is the InChIKey of CID 59901972?
The InChIKey is TXVVTTIBIQMWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-5-6(2)7(3)4/h2,5H,1,3-4H3.
What are the key properties of CID 59901972?
CID 59901972 has a molecular weight of 97.16 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59901972 is sourced from PubChem (CID 59901972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).