hydrogen sulfite;rutherfordium

HO3RfS- — CID 59902017

IUPAChydrogen sulfite;rutherfordium
SMILESO=S([O-])O.[Rf]
InChIInChI=1S/H2O3S.Rf/c1-4(2)3;/h(H2,1,2,3);/p-1
InChIKeyNDCNZMLTQNIKQT-UHFFFAOYSA-M
MW348.07 g/mol
LogP-0.66
Rot. Bonds

About hydrogen sulfite;rutherfordium

hydrogen sulfite;rutherfordium (PubChem CID 59902017) has the molecular formula HO3RfS- and a molecular weight of 348.07 g/mol. Its IUPAC name is hydrogen sulfite;rutherfordium.

Molecular Properties

Compound Namehydrogen sulfite;rutherfordium
PubChem CID59902017
Molecular FormulaHO3RfS-
Molecular Weight348.07 g/mol
Exact Mass348.09
IUPAC Namehydrogen sulfite;rutherfordium
SMILESO=S([O-])O.[Rf]
InChIInChI=1S/H2O3S.Rf/c1-4(2)3;/h(H2,1,2,3);/p-1
InChIKeyNDCNZMLTQNIKQT-UHFFFAOYSA-M
XLogP-0.66
TPSA60.36 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.07
LogP ≤ 5-0.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen sulfite;rutherfordium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfite;rutherfordium?
The IUPAC name of hydrogen sulfite;rutherfordium (CID 59902017) is hydrogen sulfite;rutherfordium.
What is the SMILES notation for hydrogen sulfite;rutherfordium?
The canonical SMILES for hydrogen sulfite;rutherfordium is O=S([O-])O.[Rf].
What is the InChIKey of hydrogen sulfite;rutherfordium?
The InChIKey is NDCNZMLTQNIKQT-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3S.Rf/c1-4(2)3;/h(H2,1,2,3);/p-1.
What are the key properties of hydrogen sulfite;rutherfordium?
hydrogen sulfite;rutherfordium has a molecular weight of 348.07 g/mol, XLogP of -0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;rutherfordium is sourced from PubChem (CID 59902017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).