C7H15NO2S — CID 59902215
(2R)-2-(ethylsulfanylmethyl)-3-(methylamino)propanoic acid (PubChem CID 59902215) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is (2R)-2-(ethylsulfanylmethyl)-3-(methylamino)propanoic acid.
| Compound Name | (2R)-2-(ethylsulfanylmethyl)-3-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 59902215 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (2R)-2-(ethylsulfanylmethyl)-3-(methylamino)propanoic acid |
| SMILES | CCSC[C@H](CNC)C(=O)O |
| InChI | InChI=1S/C7H15NO2S/c1-3-11-5-6(4-8-2)7(9)10/h6,8H,3-5H2,1-2H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | FVLDWQUIJBZEMZ-LURJTMIESA-N |
| XLogP | 0.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |