About methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate
methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate (PubChem CID 59902548) has the molecular formula C12H22N2O5
and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate |
| PubChem CID | 59902548 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN[C@@H]1C(=O)N(C)CCC(O)O |
| InChI | InChI=1S/C12H22N2O5/c1-14(7-5-9(15)16)11(17)10-8(12(18)19-2)4-3-6-13-10/h8-10,13,15-16H,3-7H2,1-2H3/t8-,10+/m1/s1 |
| InChIKey | GXQMCLJRQYLAFV-SCZZXKLOSA-N |
| XLogP | -1.31 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate?
The IUPAC name of methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate (CID 59902548) is methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate.
What is the SMILES notation for methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate?
The canonical SMILES for methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate is COC(=O)[C@@H]1CCCN[C@@H]1C(=O)N(C)CCC(O)O.
What is the InChIKey of methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate?
The InChIKey is GXQMCLJRQYLAFV-SCZZXKLOSA-N. The full InChI is InChI=1S/C12H22N2O5/c1-14(7-5-9(15)16)11(17)10-8(12(18)19-2)4-3-6-13-10/h8-10,13,15-16H,3-7H2,1-2H3/t8-,10+/m1/s1.
What are the key properties of methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate?
methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate has a molecular weight of 274.32 g/mol, XLogP of -1.31, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-2-[3,3-dihydroxypropyl(methyl)carbamoyl]piperidine-3-carboxylate is sourced from PubChem (CID 59902548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).