About 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde
6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde (PubChem CID 59903333) has the molecular formula C18H12BrNO2
and a molecular weight of 354.20 g/mol. Its IUPAC name is 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde.
Molecular Properties
| Compound Name | 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde |
| PubChem CID | 59903333 |
| Molecular Formula | C18H12BrNO2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde |
| SMILES | O=Cc1ccc2cc(-c3ccc(CBr)cc3)cc(C=O)c2n1 |
| InChI | InChI=1S/C18H12BrNO2/c19-9-12-1-3-13(4-2-12)15-7-14-5-6-17(11-22)20-18(14)16(8-15)10-21/h1-8,10-11H,9H2 |
| InChIKey | OFQFKHDUIPRZHW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde?
The IUPAC name of 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde (CID 59903333) is 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde.
What is the SMILES notation for 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde?
The canonical SMILES for 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde is O=Cc1ccc2cc(-c3ccc(CBr)cc3)cc(C=O)c2n1.
What is the InChIKey of 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde?
The InChIKey is OFQFKHDUIPRZHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrNO2/c19-9-12-1-3-13(4-2-12)15-7-14-5-6-17(11-22)20-18(14)16(8-15)10-21/h1-8,10-11H,9H2.
What are the key properties of 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde?
6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde has a molecular weight of 354.20 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(bromomethyl)phenyl]quinoline-2,8-dicarbaldehyde is sourced from PubChem (CID 59903333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).