C13H11BrN2O2S2 — CID 599035
1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 599035) has the molecular formula C13H11BrN2O2S2 and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 599035 |
| Molecular Formula | C13H11BrN2O2S2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(SC2=NCCS2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H11BrN2O2S2/c14-8-1-3-9(4-2-8)16-11(17)7-10(12(16)18)20-13-15-5-6-19-13/h1-4,10H,5-7H2 |
| InChIKey | SZZOQNMSEZJUSN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|