About [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane
[(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane (PubChem CID 59903542) has the molecular formula C22H21P
and a molecular weight of 316.38 g/mol. Its IUPAC name is [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane.
Molecular Properties
| Compound Name | [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane |
| PubChem CID | 59903542 |
| Molecular Formula | C22H21P |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane |
| SMILES | Cc1cccc2c1[C@@H](P(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C22H21P/c1-17-9-8-10-18-15-16-21(22(17)18)23(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-14,21H,15-16H2,1H3/t21-/m0/s1 |
| InChIKey | PINOZFYPXCXLLY-NRFANRHFSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane?
The IUPAC name of [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane (CID 59903542) is [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane.
What is the SMILES notation for [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane?
The canonical SMILES for [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane is Cc1cccc2c1[C@@H](P(c1ccccc1)c1ccccc1)CC2.
What is the InChIKey of [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane?
The InChIKey is PINOZFYPXCXLLY-NRFANRHFSA-N. The full InChI is InChI=1S/C22H21P/c1-17-9-8-10-18-15-16-21(22(17)18)23(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-14,21H,15-16H2,1H3/t21-/m0/s1.
What are the key properties of [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane?
[(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane has a molecular weight of 316.38 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-7-methyl-2,3-dihydro-1H-inden-1-yl]-diphenylphosphane is sourced from PubChem (CID 59903542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).