About 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione
2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 59904022) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
| PubChem CID | 59904022 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | CCOC1(OCC)CCN(C)[C@H](CN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C19H26N2O4/c1-4-24-19(25-5-2)10-11-20(3)14(12-19)13-21-17(22)15-8-6-7-9-16(15)18(21)23/h6-9,14H,4-5,10-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | FULLYLATFDBIMM-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione?
The IUPAC name of 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione (CID 59904022) is 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione?
The canonical SMILES for 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione is CCOC1(OCC)CCN(C)[C@H](CN2C(=O)c3ccccc3C2=O)C1.
What is the InChIKey of 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione?
The InChIKey is FULLYLATFDBIMM-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-4-24-19(25-5-2)10-11-20(3)14(12-19)13-21-17(22)15-8-6-7-9-16(15)18(21)23/h6-9,14H,4-5,10-13H2,1-3H3/t14-/m0/s1.
What are the key properties of 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione?
2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione has a molecular weight of 346.43 g/mol, XLogP of 2.15, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-4,4-diethoxy-1-methylpiperidin-2-yl]methyl]isoindole-1,3-dione is sourced from PubChem (CID 59904022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).