C14H12F2N4 — CID 59904772
5-[(2E,4E)-6-fluoro-5-(fluoromethyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole (PubChem CID 59904772) has the molecular formula C14H12F2N4 and a molecular weight of 274.27 g/mol. Its IUPAC name is 5-[(2E,4E)-6-fluoro-5-(fluoromethyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole.
| Compound Name | 5-[(2E,4E)-6-fluoro-5-(fluoromethyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole |
|---|---|
| PubChem CID | 59904772 |
| Molecular Formula | C14H12F2N4 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-[(2E,4E)-6-fluoro-5-(fluoromethyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole |
| SMILES | C=C=C=C=C=C(F)/C(CF)=C(\C=C\C)c1nnnn1C |
| InChI | InChI=1S/C14H12F2N4/c1-4-6-7-9-13(16)12(10-15)11(8-5-2)14-17-18-19-20(14)3/h5,8H,1,10H2,2-3H3/b8-5+,12-11+ |
| InChIKey | CHRWYOIOXLJTOF-CQYWEGEGSA-N |
| XLogP | 2.61 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|