About 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+))
2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) (PubChem CID 59905049) has the molecular formula C6H10O3Rb2
and a molecular weight of 301.08 g/mol. Its IUPAC name is 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)).
Molecular Properties
| Compound Name | 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) |
| PubChem CID | 59905049 |
| Molecular Formula | C6H10O3Rb2 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.89 |
| IUPAC Name | 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) |
| SMILES | CC1OC(C)C([O-])C1[O-].[Rb+].[Rb+] |
| InChI | InChI=1S/C6H10O3.2Rb/c1-3-5(7)6(8)4(2)9-3;;/h3-6H,1-2H3;;/q-2;2*+1 |
| InChIKey | ZWIUJDUOKXBZQV-UHFFFAOYSA-N |
| XLogP | -7.74 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | -7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+))?
The IUPAC name of 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) (CID 59905049) is 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)).
What is the SMILES notation for 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+))?
The canonical SMILES for 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) is CC1OC(C)C([O-])C1[O-].[Rb+].[Rb+].
What is the InChIKey of 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+))?
The InChIKey is ZWIUJDUOKXBZQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.2Rb/c1-3-5(7)6(8)4(2)9-3;;/h3-6H,1-2H3;;/q-2;2*+1.
What are the key properties of 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+))?
2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) has a molecular weight of 301.08 g/mol, XLogP of -7.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyloxolane-3,4-diolate;bis(rubidium(1+)) is sourced from PubChem (CID 59905049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).