About (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium
(Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium (PubChem CID 59905068) has the molecular formula C9H12N2OY-2
and a molecular weight of 253.11 g/mol. Its IUPAC name is (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium.
Molecular Properties
| Compound Name | (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium |
| PubChem CID | 59905068 |
| Molecular Formula | C9H12N2OY-2 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium |
| SMILES | [CH2-]CC(=C(\[CH2-])CC)/C(C#N)=N\O.[Y] |
| InChI | InChI=1S/C9H12N2O.Y/c1-4-7(3)8(5-2)9(6-10)11-12;/h12H,2-5H2,1H3;/q-2;/b8-7-,11-9-; |
| InChIKey | LIVSUZOTCPYQRS-HIABXNDZSA-N |
| XLogP | 2.10 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium?
The IUPAC name of (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium (CID 59905068) is (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium.
What is the SMILES notation for (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium?
The canonical SMILES for (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium is [CH2-]CC(=C(\[CH2-])CC)/C(C#N)=N\O.[Y].
What is the InChIKey of (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium?
The InChIKey is LIVSUZOTCPYQRS-HIABXNDZSA-N. The full InChI is InChI=1S/C9H12N2O.Y/c1-4-7(3)8(5-2)9(6-10)11-12;/h12H,2-5H2,1H3;/q-2;/b8-7-,11-9-;.
What are the key properties of (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium?
(Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium has a molecular weight of 253.11 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-3-ethyl-2-hydroxyimino-4-methanidylhex-3-enenitrile;yttrium is sourced from PubChem (CID 59905068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).