C22H13O4- — CID 59905286
2-[3-(1,3-dioxoinden-2-ylidene)-2-methylprop-1-enyl]-3-oxoinden-1-olate (PubChem CID 59905286) has the molecular formula C22H13O4- and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoinden-2-ylidene)-2-methylprop-1-enyl]-3-oxoinden-1-olate.
| Compound Name | 2-[3-(1,3-dioxoinden-2-ylidene)-2-methylprop-1-enyl]-3-oxoinden-1-olate |
|---|---|
| PubChem CID | 59905286 |
| Molecular Formula | C22H13O4- |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-[3-(1,3-dioxoinden-2-ylidene)-2-methylprop-1-enyl]-3-oxoinden-1-olate |
| SMILES | CC(=CC1=C([O-])c2ccccc2C1=O)C=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H14O4/c1-12(10-17-19(23)13-6-2-3-7-14(13)20(17)24)11-18-21(25)15-8-4-5-9-16(15)22(18)26/h2-11,23H,1H3/p-1 |
| InChIKey | QCBJDZJQNRJLQZ-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|