About 2-phenylethynylbenzene;tungsten;vanadium
2-phenylethynylbenzene;tungsten;vanadium (PubChem CID 59905381) has the molecular formula C14H8VW-2
and a molecular weight of 411.00 g/mol. Its IUPAC name is 2-phenylethynylbenzene;tungsten;vanadium.
Molecular Properties
| Compound Name | 2-phenylethynylbenzene;tungsten;vanadium |
| PubChem CID | 59905381 |
| Molecular Formula | C14H8VW-2 |
| Molecular Weight | 411.00 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | 2-phenylethynylbenzene;tungsten;vanadium |
| SMILES | C(#Cc1cc[c-]cc1)c1cc[c-]cc1.[V].[W] |
| InChI | InChI=1S/C14H8.V.W/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h3-10H;;/q-2;; |
| InChIKey | CZBROJBUBLZLHL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.00 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethynylbenzene;tungsten;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethynylbenzene;tungsten;vanadium?
The IUPAC name of 2-phenylethynylbenzene;tungsten;vanadium (CID 59905381) is 2-phenylethynylbenzene;tungsten;vanadium.
What is the SMILES notation for 2-phenylethynylbenzene;tungsten;vanadium?
The canonical SMILES for 2-phenylethynylbenzene;tungsten;vanadium is C(#Cc1cc[c-]cc1)c1cc[c-]cc1.[V].[W].
What is the InChIKey of 2-phenylethynylbenzene;tungsten;vanadium?
The InChIKey is CZBROJBUBLZLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8.V.W/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h3-10H;;/q-2;;.
What are the key properties of 2-phenylethynylbenzene;tungsten;vanadium?
2-phenylethynylbenzene;tungsten;vanadium has a molecular weight of 411.00 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethynylbenzene;tungsten;vanadium is sourced from PubChem (CID 59905381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).