About cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol
cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol (PubChem CID 59905567) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol.
Molecular Properties
| Compound Name | cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol |
| PubChem CID | 59905567 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol |
| SMILES | COC[C@@]1(O)C[C@@H](C)CC1O |
| InChI | InChI=1S/C8H16O3/c1-6-3-7(9)8(10,4-6)5-11-2/h6-7,9-10H,3-5H2,1-2H3/t6-,7?,8-/m0/s1 |
| InChIKey | KIRFEAGYPPMITF-PPSBICQBSA-N |
| XLogP | 0.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol?
The IUPAC name of cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol (CID 59905567) is cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol.
What is the SMILES notation for cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol?
The canonical SMILES for cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol is COC[C@@]1(O)C[C@@H](C)CC1O.
What is the InChIKey of cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol?
The InChIKey is KIRFEAGYPPMITF-PPSBICQBSA-N. The full InChI is InChI=1S/C8H16O3/c1-6-3-7(9)8(10,4-6)5-11-2/h6-7,9-10H,3-5H2,1-2H3/t6-,7?,8-/m0/s1.
What are the key properties of cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol?
cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol has a molecular weight of 160.21 g/mol, XLogP of 0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,4S)-1-(methoxymethyl)-4-methylcyclopentane-1,2-diol is sourced from PubChem (CID 59905567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).