C19H37O7PW2 — CID 59905603
hydroxy-methyl-[[(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl]oxy]-[[(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methoxy]phosphanium;tungsten (PubChem CID 59905603) has the molecular formula C19H37O7PW2 and a molecular weight of 776.15 g/mol. Its IUPAC name is hydroxy-methyl-[[(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl]oxy]-[[(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methoxy]phosphanium;tungsten.
| Compound Name | hydroxy-methyl-[[(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl]oxy]-[[(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methoxy]phosphanium;tungsten |
|---|---|
| PubChem CID | 59905603 |
| Molecular Formula | C19H37O7PW2 |
| Molecular Weight | 776.15 g/mol |
| Exact Mass | 776.13 |
| IUPAC Name | hydroxy-methyl-[[(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl]oxy]-[[(2R,5S)-5-methyl-3-propan-2-yloxyoxolan-2-yl]methoxy]phosphanium;tungsten |
| SMILES | CC(C)OC[C@H]1O[C@@H](C)[CH-][C@H]1O[P+](C)(O)OC[C@H]1O[C@@H](C)CC1OC(C)C.[W].[W] |
| InChI | InChI=1S/C19H37O7P.2W/c1-12(2)21-10-18-17(9-15(6)24-18)26-27(7,20)22-11-19-16(23-13(3)4)8-14(5)25-19;;/h9,12-20H,8,10-11H2,1-7H3;;/t14-,15-,16?,17+,18+,19+,27?;;/m0../s1 |
| InChIKey | XLPJASYQKJHPPE-SXWPIMOHSA-N |
| XLogP | 3.16 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|