C11H17NO3 — CID 59906159
3-[(2R,3S,4R)-4-hydroxy-2-[(E,3S)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile (PubChem CID 59906159) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[(2R,3S,4R)-4-hydroxy-2-[(E,3S)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile.
| Compound Name | 3-[(2R,3S,4R)-4-hydroxy-2-[(E,3S)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile |
|---|---|
| PubChem CID | 59906159 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-[(2R,3S,4R)-4-hydroxy-2-[(E,3S)-3-hydroxybut-1-enyl]oxolan-3-yl]propanenitrile |
| SMILES | C[C@H](O)/C=C/[C@H]1OC[C@H](O)[C@@H]1CCC#N |
| InChI | InChI=1S/C11H17NO3/c1-8(13)4-5-11-9(3-2-6-12)10(14)7-15-11/h4-5,8-11,13-14H,2-3,7H2,1H3/b5-4+/t8-,9-,10-,11+/m0/s1 |
| InChIKey | SDANMJYRZJWKJY-LYOZZVMASA-N |
| XLogP | 0.60 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|