C26H48O4Si — CID 59906165
propan-2-yl (Z)-7-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]hept-4-enoate (PubChem CID 59906165) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]hept-4-enoate.
| Compound Name | propan-2-yl (Z)-7-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]hept-4-enoate |
|---|---|
| PubChem CID | 59906165 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | propan-2-yl (Z)-7-[(2R,3S,4R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-4-methyloxolan-3-yl]hept-4-enoate |
| SMILES | CC[C@@H](/C=C/[C@H]1OC[C@H](C)[C@@H]1CC/C=C\CCC(=O)OC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O4Si/c1-10-22(30-31(8,9)26(5,6)7)17-18-24-23(21(4)19-28-24)15-13-11-12-14-16-25(27)29-20(2)3/h11-12,17-18,20-24H,10,13-16,19H2,1-9H3/b12-11-,18-17+/t21-,22-,23-,24+/m0/s1 |
| InChIKey | UMFBDWMEZPRRGE-YZTNQOIRSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|