C23H29F2N5O2 — CID 59906443
(2S)-2-[[(2S)-2-amino-3-(3,4-difluorophenyl)propanoyl]amino]-5-(1-aminoethylideneamino)-N-benzylpentanamide (PubChem CID 59906443) has the molecular formula C23H29F2N5O2 and a molecular weight of 445.51 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(3,4-difluorophenyl)propanoyl]amino]-5-(1-aminoethylideneamino)-N-benzylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(3,4-difluorophenyl)propanoyl]amino]-5-(1-aminoethylideneamino)-N-benzylpentanamide |
|---|---|
| PubChem CID | 59906443 |
| Molecular Formula | C23H29F2N5O2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(3,4-difluorophenyl)propanoyl]amino]-5-(1-aminoethylideneamino)-N-benzylpentanamide |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)[C@@H](N)Cc1ccc(F)c(F)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H29F2N5O2/c1-15(26)28-11-5-8-21(23(32)29-14-16-6-3-2-4-7-16)30-22(31)20(27)13-17-9-10-18(24)19(25)12-17/h2-4,6-7,9-10,12,20-21H,5,8,11,13-14,27H2,1H3,(H2,26,28)(H,29,32)(H,30,31)/t20-,21-/m0/s1 |
| InChIKey | CVAZJSRLHMHEAZ-SFTDATJTSA-N |
| XLogP | 1.79 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|