C25H35N3O6S — CID 59907063
methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.3.1.14,7]henicosa-1(19),16(20),17-triene-6-carboxylate (PubChem CID 59907063) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.3.1.14,7]henicosa-1(19),16(20),17-triene-6-carboxylate.
| Compound Name | methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.3.1.14,7]henicosa-1(19),16(20),17-triene-6-carboxylate |
|---|---|
| PubChem CID | 59907063 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[14.3.1.14,7]henicosa-1(19),16(20),17-triene-6-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)C(C1CCCCC1)NC(=O)CCCCc1cccc(c1)S(=O)(=O)N2 |
| InChI | InChI=1S/C25H35N3O6S/c1-34-25(31)21-15-19-16-28(21)24(30)23(18-10-3-2-4-11-18)26-22(29)13-6-5-8-17-9-7-12-20(14-17)35(32,33)27-19/h7,9,12,14,18-19,21,23,27H,2-6,8,10-11,13,15-16H2,1H3,(H,26,29)/t19-,21?,23?/m1/s1 |
| InChIKey | AAKSKXIKWSOAMD-VWRAKTAISA-N |
| XLogP | 1.90 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |