C23H31N3O6S — CID 59907145
methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[12.2.2.14,7]nonadeca-1(17),14(18),15-triene-6-carboxylate (PubChem CID 59907145) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[12.2.2.14,7]nonadeca-1(17),14(18),15-triene-6-carboxylate.
| Compound Name | methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[12.2.2.14,7]nonadeca-1(17),14(18),15-triene-6-carboxylate |
|---|---|
| PubChem CID | 59907145 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | methyl (4R)-9-cyclohexyl-2,2,8,11-tetraoxo-2λ6-thia-3,7,10-triazatricyclo[12.2.2.14,7]nonadeca-1(17),14(18),15-triene-6-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)C(C1CCCCC1)NC(=O)CCc1ccc(cc1)S(=O)(=O)N2 |
| InChI | InChI=1S/C23H31N3O6S/c1-32-23(29)19-13-17-14-26(19)22(28)21(16-5-3-2-4-6-16)24-20(27)12-9-15-7-10-18(11-8-15)33(30,31)25-17/h7-8,10-11,16-17,19,21,25H,2-6,9,12-14H2,1H3,(H,24,27)/t17-,19?,21?/m1/s1 |
| InChIKey | OSEYBJGUOPNOST-FQVISZRSSA-N |
| XLogP | 1.12 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |