C15H23O2S- — CID 59907377
(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-diene-1-sulfinate (PubChem CID 59907377) has the molecular formula C15H23O2S- and a molecular weight of 267.41 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-diene-1-sulfinate.
| Compound Name | (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-diene-1-sulfinate |
|---|---|
| PubChem CID | 59907377 |
| Molecular Formula | C15H23O2S- |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-diene-1-sulfinate |
| SMILES | CC1=C(/C=C/C(C)=C/CS(=O)[O-])C(C)(C)CCC1 |
| InChI | InChI=1S/C15H24O2S/c1-12(9-11-18(16)17)7-8-14-13(2)6-5-10-15(14,3)4/h7-9H,5-6,10-11H2,1-4H3,(H,16,17)/p-1/b8-7+,12-9+ |
| InChIKey | MHKLQVMPZGPRSR-ANKZSMJWSA-M |
| XLogP | 3.89 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|