C31H33BN4O6 — CID 59907515
CID 59907515 (PubChem CID 59907515) has the molecular formula C31H33BN4O6 and a molecular weight of 568.44 g/mol.
| Compound Name | CID 59907515 |
|---|---|
| PubChem CID | 59907515 |
| Molecular Formula | C31H33BN4O6 |
| Molecular Weight | 568.44 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H](C(=O)N1C[C@H](Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)C[C@H]1C(=O)NC1(C=O)CC1)C(C)C |
| InChI | InChI=1S/C31H33BN4O6/c1-18(2)27(34-30(32)40)29(39)36-16-21(14-25(36)28(38)35-31(17-37)11-12-31)42-26-15-23(19-7-5-4-6-8-19)33-24-13-20(41-3)9-10-22(24)26/h4-10,13,15,17-18,21,25,27H,11-12,14,16H2,1-3H3,(H,34,40)(H,35,38)/t21-,25+,27+/m1/s1 |
| InChIKey | QREPGWBKYJJDCD-UDZXTKBFSA-N |
| XLogP | 3.01 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|