C22H35FO5 — CID 59907698
(4R,5S,6S,7S,9R,11E,13E,16S)-7-ethyl-16-(2-fluoroethyl)-4,6-dihydroxy-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 59907698) has the molecular formula C22H35FO5 and a molecular weight of 398.52 g/mol. Its IUPAC name is (4R,5S,6S,7S,9R,11E,13E,16S)-7-ethyl-16-(2-fluoroethyl)-4,6-dihydroxy-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | (4R,5S,6S,7S,9R,11E,13E,16S)-7-ethyl-16-(2-fluoroethyl)-4,6-dihydroxy-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 59907698 |
| Molecular Formula | C22H35FO5 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (4R,5S,6S,7S,9R,11E,13E,16S)-7-ethyl-16-(2-fluoroethyl)-4,6-dihydroxy-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | CC[C@H]1C[C@@H](C)C(=O)/C=C/C(C)=C/C[C@@H](CCF)OC(=O)C[C@@H](O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C22H35FO5/c1-5-17-12-15(3)19(24)9-7-14(2)6-8-18(10-11-23)28-21(26)13-20(25)16(4)22(17)27/h6-7,9,15-18,20,22,25,27H,5,8,10-13H2,1-4H3/b9-7+,14-6+/t15-,16+,17+,18+,20-,22-/m1/s1 |
| InChIKey | KOVBNNKEQCVWKK-JJLKMLKSSA-N |
| XLogP | 3.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |