C13H27N — CID 59907710
(E,3R)-2,2,3,7,7-pentamethyloct-5-en-4-amine (PubChem CID 59907710) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is (E,3R)-2,2,3,7,7-pentamethyloct-5-en-4-amine.
| Compound Name | (E,3R)-2,2,3,7,7-pentamethyloct-5-en-4-amine |
|---|---|
| PubChem CID | 59907710 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | (E,3R)-2,2,3,7,7-pentamethyloct-5-en-4-amine |
| SMILES | C[C@@H](C(N)/C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27N/c1-10(13(5,6)7)11(14)8-9-12(2,3)4/h8-11H,14H2,1-7H3/b9-8+/t10-,11?/m0/s1 |
| InChIKey | IDMIZPHPDRDHPT-GQUHTFLRSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|