C30H59NO8 — CID 59908136
(2R,5R)-2-[2-[[(E)-heptadec-8-enoxy]methylamino]-3-hydroxyhexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59908136) has the molecular formula C30H59NO8 and a molecular weight of 561.80 g/mol. Its IUPAC name is (2R,5R)-2-[2-[[(E)-heptadec-8-enoxy]methylamino]-3-hydroxyhexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,5R)-2-[2-[[(E)-heptadec-8-enoxy]methylamino]-3-hydroxyhexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59908136 |
| Molecular Formula | C30H59NO8 |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 561.42 |
| IUPAC Name | (2R,5R)-2-[2-[[(E)-heptadec-8-enoxy]methylamino]-3-hydroxyhexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCC/C=C/CCCCCCCOCNC(CO[C@@H]1OC(CO)[C@H](O)C(O)C1O)C(O)CCC |
| InChI | InChI=1S/C30H59NO8/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-37-23-31-24(25(33)19-4-2)22-38-30-29(36)28(35)27(34)26(21-32)39-30/h11-12,24-36H,3-10,13-23H2,1-2H3/b12-11+/t24?,25?,26?,27-,28?,29?,30+/m0/s1 |
| InChIKey | RMHAXNMBSJAIST-CXXGYGMMSA-N |
| XLogP | 3.54 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|