C11H22N2O2 — CID 59908451
1-(methoxymethyl)-3,3,4,5,5-pentamethylpiperazin-2-one (PubChem CID 59908451) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(methoxymethyl)-3,3,4,5,5-pentamethylpiperazin-2-one.
| Compound Name | 1-(methoxymethyl)-3,3,4,5,5-pentamethylpiperazin-2-one |
|---|---|
| PubChem CID | 59908451 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-(methoxymethyl)-3,3,4,5,5-pentamethylpiperazin-2-one |
| SMILES | COCN1CC(C)(C)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C11H22N2O2/c1-10(2)7-13(8-15-6)9(14)11(3,4)12(10)5/h7-8H2,1-6H3 |
| InChIKey | GQDCIPAVQUUBLU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |