About 2,4-dibutyl-6-propyl-1,3,5-triazine
2,4-dibutyl-6-propyl-1,3,5-triazine (PubChem CID 59908452) has the molecular formula C14H25N3
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2,4-dibutyl-6-propyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-dibutyl-6-propyl-1,3,5-triazine |
| PubChem CID | 59908452 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2,4-dibutyl-6-propyl-1,3,5-triazine |
| SMILES | CCCCc1nc(CCC)nc(CCCC)n1 |
| InChI | InChI=1S/C14H25N3/c1-4-7-10-13-15-12(9-6-3)16-14(17-13)11-8-5-2/h4-11H2,1-3H3 |
| InChIKey | NSFZKUOGHOPROF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dibutyl-6-propyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibutyl-6-propyl-1,3,5-triazine?
The IUPAC name of 2,4-dibutyl-6-propyl-1,3,5-triazine (CID 59908452) is 2,4-dibutyl-6-propyl-1,3,5-triazine.
What is the SMILES notation for 2,4-dibutyl-6-propyl-1,3,5-triazine?
The canonical SMILES for 2,4-dibutyl-6-propyl-1,3,5-triazine is CCCCc1nc(CCC)nc(CCCC)n1.
What is the InChIKey of 2,4-dibutyl-6-propyl-1,3,5-triazine?
The InChIKey is NSFZKUOGHOPROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3/c1-4-7-10-13-15-12(9-6-3)16-14(17-13)11-8-5-2/h4-11H2,1-3H3.
What are the key properties of 2,4-dibutyl-6-propyl-1,3,5-triazine?
2,4-dibutyl-6-propyl-1,3,5-triazine has a molecular weight of 235.37 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibutyl-6-propyl-1,3,5-triazine is sourced from PubChem (CID 59908452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).