C19H28N6O4 — CID 59908754
(2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-pyrimidin-2-ylpyrrolidine-1,2-dicarboxamide (PubChem CID 59908754) has the molecular formula C19H28N6O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-pyrimidin-2-ylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-pyrimidin-2-ylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 59908754 |
| Molecular Formula | C19H28N6O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-pyrimidin-2-ylpyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(CN(CCC1CCCC1)C(=O)N1CCC[C@H]1C(=O)Nc1ncccn1)NO |
| InChI | InChI=1S/C19H28N6O4/c26-16(23-29)13-24(12-8-14-5-1-2-6-14)19(28)25-11-3-7-15(25)17(27)22-18-20-9-4-10-21-18/h4,9-10,14-15,29H,1-3,5-8,11-13H2,(H,23,26)(H,20,21,22,27)/t15-/m0/s1 |
| InChIKey | NIOHLURXMLIINH-HNNXBMFYSA-N |
| XLogP | 1.39 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|