C16H29NO3 — CID 59908798
methyl (2S)-6-(7-ethoxy-3,4,5,6-tetrahydro-2H-azepin-2-yl)-2-methylhexanoate (PubChem CID 59908798) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is methyl (2S)-6-(7-ethoxy-3,4,5,6-tetrahydro-2H-azepin-2-yl)-2-methylhexanoate.
| Compound Name | methyl (2S)-6-(7-ethoxy-3,4,5,6-tetrahydro-2H-azepin-2-yl)-2-methylhexanoate |
|---|---|
| PubChem CID | 59908798 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | methyl (2S)-6-(7-ethoxy-3,4,5,6-tetrahydro-2H-azepin-2-yl)-2-methylhexanoate |
| SMILES | CCOC1=NC(CCCC[C@H](C)C(=O)OC)CCCC1 |
| InChI | InChI=1S/C16H29NO3/c1-4-20-15-12-8-7-11-14(17-15)10-6-5-9-13(2)16(18)19-3/h13-14H,4-12H2,1-3H3/t13-,14?/m0/s1 |
| InChIKey | BUVTVPXSTRPNEB-LSLKUGRBSA-N |
| XLogP | 3.73 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|