C15H28S — CID 59908876
2,3-ditert-butyl-4,5-dimethyl-1-methylidene-2,3-dihydrothiophene (PubChem CID 59908876) has the molecular formula C15H28S and a molecular weight of 240.46 g/mol. Its IUPAC name is 2,3-ditert-butyl-4,5-dimethyl-1-methylidene-2,3-dihydrothiophene.
| Compound Name | 2,3-ditert-butyl-4,5-dimethyl-1-methylidene-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 59908876 |
| Molecular Formula | C15H28S |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2,3-ditert-butyl-4,5-dimethyl-1-methylidene-2,3-dihydrothiophene |
| SMILES | C=S1C(C)=C(C)C(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C15H28S/c1-10-11(2)16(9)13(15(6,7)8)12(10)14(3,4)5/h12-13H,9H2,1-8H3 |
| InChIKey | HOIZRBABUPKJEN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|