C24H18N2S6 — CID 59909115
(5Z)-5-[(2E,4E)-3-methyl-5-(3-phenyl-4-sulfanyl-2-sulfanylidene-1,3-thiazol-5-yl)penta-2,4-dienylidene]-3-phenyl-1,3-thiazolidine-2,4-dithione (PubChem CID 59909115) has the molecular formula C24H18N2S6 and a molecular weight of 526.82 g/mol. Its IUPAC name is (5Z)-5-[(2E,4E)-3-methyl-5-(3-phenyl-4-sulfanyl-2-sulfanylidene-1,3-thiazol-5-yl)penta-2,4-dienylidene]-3-phenyl-1,3-thiazolidine-2,4-dithione.
| Compound Name | (5Z)-5-[(2E,4E)-3-methyl-5-(3-phenyl-4-sulfanyl-2-sulfanylidene-1,3-thiazol-5-yl)penta-2,4-dienylidene]-3-phenyl-1,3-thiazolidine-2,4-dithione |
|---|---|
| PubChem CID | 59909115 |
| Molecular Formula | C24H18N2S6 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | (5Z)-5-[(2E,4E)-3-methyl-5-(3-phenyl-4-sulfanyl-2-sulfanylidene-1,3-thiazol-5-yl)penta-2,4-dienylidene]-3-phenyl-1,3-thiazolidine-2,4-dithione |
| SMILES | CC(/C=C/c1sc(=S)n(-c2ccccc2)c1S)=C\C=C1/SC(=S)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C24H18N2S6/c1-16(12-14-19-21(27)25(23(29)31-19)17-8-4-2-5-9-17)13-15-20-22(28)26(24(30)32-20)18-10-6-3-7-11-18/h2-15,27H,1H3/b14-12+,16-13+,20-15- |
| InChIKey | AWJJBKVFUKKSIW-QLSUPALWSA-N |
| XLogP | 8.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|