About dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol
dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol (PubChem CID 59909204) has the molecular formula C14H26Cl2O2STi
and a molecular weight of 377.20 g/mol. Its IUPAC name is dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol |
| PubChem CID | 59909204 |
| Molecular Formula | C14H26Cl2O2STi |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)C(SC2CC(C)CCC2O)C1.Cl[Ti]Cl |
| InChI | InChI=1S/C14H26O2S.2ClH.Ti/c1-9-3-5-11(15)13(7-9)17-14-8-10(2)4-6-12(14)16;;;/h9-16H,3-8H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZSSHKPACXWVEOK-UHFFFAOYSA-L |
| XLogP | 4.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol?
The IUPAC name of dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol (CID 59909204) is dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol.
What is the SMILES notation for dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol?
The canonical SMILES for dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol is CC1CCC(O)C(SC2CC(C)CCC2O)C1.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol?
The InChIKey is ZSSHKPACXWVEOK-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H26O2S.2ClH.Ti/c1-9-3-5-11(15)13(7-9)17-14-8-10(2)4-6-12(14)16;;;/h9-16H,3-8H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol?
dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol has a molecular weight of 377.20 g/mol, XLogP of 4.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;2-(2-hydroxy-5-methylcyclohexyl)sulfanyl-4-methylcyclohexan-1-ol is sourced from PubChem (CID 59909204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).