About ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate
ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate (PubChem CID 59909410) has the molecular formula C12H22N2O6
and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate |
| PubChem CID | 59909410 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate |
| SMILES | CCOC(=O)[C@H](CC)NC(=O)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C12H22N2O6/c1-5-8(12(17)20-6-2)14-11(16)10(15)13-7-9(18-3)19-4/h8-9H,5-7H2,1-4H3,(H,13,15)(H,14,16)/t8-/m0/s1 |
| InChIKey | DLKCNAPTYRCDMD-QMMMGPOBSA-N |
| XLogP | -0.82 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate?
The IUPAC name of ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate (CID 59909410) is ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate.
What is the SMILES notation for ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate?
The canonical SMILES for ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate is CCOC(=O)[C@H](CC)NC(=O)C(=O)NCC(OC)OC.
What is the InChIKey of ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate?
The InChIKey is DLKCNAPTYRCDMD-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H22N2O6/c1-5-8(12(17)20-6-2)14-11(16)10(15)13-7-9(18-3)19-4/h8-9H,5-7H2,1-4H3,(H,13,15)(H,14,16)/t8-/m0/s1.
What are the key properties of ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate?
ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate has a molecular weight of 290.32 g/mol, XLogP of -0.82, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[[2-(2,2-dimethoxyethylamino)-2-oxoacetyl]amino]butanoate is sourced from PubChem (CID 59909410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).