C15H22N4O4 — CID 59909437
(2S)-2-[2-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-1-yl]butanoic acid (PubChem CID 59909437) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is (2S)-2-[2-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[2-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 59909437 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (2S)-2-[2-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-1-yl]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)n1ccnc(NCCCN2CCCC2=O)c1=O |
| InChI | InChI=1S/C15H22N4O4/c1-2-11(15(22)23)19-10-7-17-13(14(19)21)16-6-4-9-18-8-3-5-12(18)20/h7,10-11H,2-6,8-9H2,1H3,(H,16,17)(H,22,23)/t11-/m0/s1 |
| InChIKey | ASJBVJYXHWFKJN-NSHDSACASA-N |
| XLogP | 0.70 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|