C9H17NO3 — CID 59909590
(2S,3S,4R)-5-methoxy-N,3,4-trimethyloxolane-2-carboxamide (PubChem CID 59909590) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (2S,3S,4R)-5-methoxy-N,3,4-trimethyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R)-5-methoxy-N,3,4-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 59909590 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2S,3S,4R)-5-methoxy-N,3,4-trimethyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1OC(OC)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H17NO3/c1-5-6(2)9(12-4)13-7(5)8(11)10-3/h5-7,9H,1-4H3,(H,10,11)/t5-,6+,7-,9?/m0/s1 |
| InChIKey | BUSJABNKLKOUQX-WPRFRAJKSA-N |
| XLogP | 0.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |