About 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one
3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 599103) has the molecular formula C7H9ClN2O
and a molecular weight of 172.61 g/mol. Its IUPAC name is 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one |
| PubChem CID | 599103 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c(Cl)c(=O)c1N |
| InChI | InChI=1S/C7H9ClN2O/c1-3-5(8)7(11)6(9)4(2)10-3/h9H2,1-2H3,(H,10,11) |
| InChIKey | IEKMEKMQGNFUIW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one?
The IUPAC name of 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one (CID 599103) is 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one.
What is the SMILES notation for 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one?
The canonical SMILES for 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one is Cc1[nH]c(C)c(Cl)c(=O)c1N.
What is the InChIKey of 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one?
The InChIKey is IEKMEKMQGNFUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O/c1-3-5(8)7(11)6(9)4(2)10-3/h9H2,1-2H3,(H,10,11).
What are the key properties of 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one?
3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one has a molecular weight of 172.61 g/mol, XLogP of 1.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-chloro-2,6-dimethyl-1H-pyridin-4-one is sourced from PubChem (CID 599103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).