C29H27FN6O3 — CID 59910460
N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-(2-propoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 59910460) has the molecular formula C29H27FN6O3 and a molecular weight of 526.57 g/mol. Its IUPAC name is N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-(2-propoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-(2-propoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 59910460 |
| Molecular Formula | C29H27FN6O3 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-(2-propoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCCOc1ccccc1-c1nc(/N=C\N(C)C)c2c(-c3ccc(C=O)o3)nn(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C29H27FN6O3/c1-4-15-38-23-12-8-6-10-21(23)27-32-28(31-18-35(2)3)25-26(24-14-13-20(17-37)39-24)34-36(29(25)33-27)16-19-9-5-7-11-22(19)30/h5-14,17-18H,4,15-16H2,1-3H3/b31-18- |
| InChIKey | LXSUNSPLIXNIDI-MNBJERMJSA-N |
| XLogP | 5.76 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|