About ethanamine;phenol;vanadium(2+)
ethanamine;phenol;vanadium(2+) (PubChem CID 59910462) has the molecular formula C8H11NOV
and a molecular weight of 188.13 g/mol. Its IUPAC name is ethanamine;phenol;vanadium(2+).
Molecular Properties
| Compound Name | ethanamine;phenol;vanadium(2+) |
| PubChem CID | 59910462 |
| Molecular Formula | C8H11NOV |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | ethanamine;phenol;vanadium(2+) |
| SMILES | Oc1cc[c-]cc1.[CH2-]CN.[V+2] |
| InChI | InChI=1S/C6H5O.C2H6N.V/c7-6-4-2-1-3-5-6;1-2-3;/h2-5,7H;1-3H2;/q2*-1;+2 |
| InChIKey | FCETVAYWLGWRME-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;phenol;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;phenol;vanadium(2+)?
The IUPAC name of ethanamine;phenol;vanadium(2+) (CID 59910462) is ethanamine;phenol;vanadium(2+).
What is the SMILES notation for ethanamine;phenol;vanadium(2+)?
The canonical SMILES for ethanamine;phenol;vanadium(2+) is Oc1cc[c-]cc1.[CH2-]CN.[V+2].
What is the InChIKey of ethanamine;phenol;vanadium(2+)?
The InChIKey is FCETVAYWLGWRME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O.C2H6N.V/c7-6-4-2-1-3-5-6;1-2-3;/h2-5,7H;1-3H2;/q2*-1;+2.
What are the key properties of ethanamine;phenol;vanadium(2+)?
ethanamine;phenol;vanadium(2+) has a molecular weight of 188.13 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;phenol;vanadium(2+) is sourced from PubChem (CID 59910462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).