About [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+)
[2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) (PubChem CID 59910529) has the molecular formula C17H22N3Rb
and a molecular weight of 353.85 g/mol. Its IUPAC name is [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+).
Molecular Properties
| Compound Name | [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) |
| PubChem CID | 59910529 |
| Molecular Formula | C17H22N3Rb |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) |
| SMILES | Cc1ccc(NCC(C)(C)Nc2ccccc2[NH-])cc1.[Rb+] |
| InChI | InChI=1S/C17H22N3.Rb/c1-13-8-10-14(11-9-13)19-12-17(2,3)20-16-7-5-4-6-15(16)18;/h4-11,18-20H,12H2,1-3H3;/q-1;+1 |
| InChIKey | OJTFUGWHKSPXFH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+)?
The IUPAC name of [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) (CID 59910529) is [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+).
What is the SMILES notation for [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+)?
The canonical SMILES for [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) is Cc1ccc(NCC(C)(C)Nc2ccccc2[NH-])cc1.[Rb+].
What is the InChIKey of [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+)?
The InChIKey is OJTFUGWHKSPXFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N3.Rb/c1-13-8-10-14(11-9-13)19-12-17(2,3)20-16-7-5-4-6-15(16)18;/h4-11,18-20H,12H2,1-3H3;/q-1;+1.
What are the key properties of [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+)?
[2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) has a molecular weight of 353.85 g/mol, XLogP of 1.99, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-methyl-1-(4-methylanilino)propan-2-yl]amino]phenyl]azanide;rubidium(1+) is sourced from PubChem (CID 59910529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).